CymitQuimica logo

CAS 898757-22-7

:

Ethyl 4-(1-azetidinylmethyl)-δ-oxobenzenepentanoate

Description:
Ethyl 4-(1-azetidinylmethyl)-δ-oxobenzenepentanoate, identified by its CAS number 898757-22-7, is a chemical compound that features a complex structure incorporating an ethyl ester functional group and an azetidine ring. This compound is characterized by its unique combination of a benzene ring with a ketone and an ester, which contributes to its potential reactivity and biological activity. The presence of the azetidine moiety suggests that it may exhibit interesting pharmacological properties, as azetidines are often found in various bioactive compounds. The molecular structure indicates that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it a candidate for further research in medicinal chemistry. Additionally, its solubility and stability in different solvents can vary, which is important for its application in synthesis and potential therapeutic uses. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, warranting further investigation into its properties and applications.
Formula:C17H23NO3
InChI:InChI=1S/C17H23NO3/c1-2-21-17(20)6-3-5-16(19)15-9-7-14(8-10-15)13-18-11-4-12-18/h7-10H,2-6,11-13H2,1H3
InChI key:InChIKey=PNBROBQXJQNRCL-UHFFFAOYSA-N
SMILES:C(CCCC(OCC)=O)(=O)C1=CC=C(CN2CCC2)C=C1
Synonyms:
  • Ethyl 4-(1-azetidinylmethyl)-δ-oxobenzenepentanoate
  • Benzenepentanoic acid, 4-(1-azetidinylmethyl)-δ-oxo-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.