CAS 898757-29-4

1-(2-chloro-4,5-difluoro-phenyl)-3-(1,3-dioxan-2-yl)propan-1-one

Description:

1-(2-chloro-4,5-difluoro-phenyl)-3-(1,3-dioxan-2-yl)propan-1-one, with the CAS number 898757-29-4, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with chlorine and fluorine atoms, as well as a dioxane moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of halogen substituents, such as chlorine and fluorine, often enhances the compound's lipophilicity and may influence its biological activity. The dioxane ring introduces a cyclic ether component, which can affect the compound's stability and interaction with other molecules. Such compounds may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to their potential biological activities. However, specific physical properties like melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₃H₁₃ClF₂O₃

InChI: InChI=1/C13H13ClF2O3/c14-9-7-11(16)10(15)6-8(9)12(17)2-3-13-18-4-1-5-19-13/h6-7,13H,1-5H2

SMILES: C1COC(CCC(=O)c2cc(c(cc2Cl)F)F)OC1

2′-Chloro-4′,5′-difluoro-3-(1,3-dioxan-2-yl)-propiophenone

CAS: 898757-29-4

Formula: C₁₃H₁₃ClF₂O₃

Purity: 97.0%

Molecular weight: 290.69

Ref: 10-F208469