CAS 898757-31-8
:ethyl 8-[4-(azetidin-1-ylmethyl)phenyl]-8-oxo-octanoate
Description:
Ethyl 8-[4-(azetidin-1-ylmethyl)phenyl]-8-oxo-octanoate, with the CAS number 898757-31-8, is a synthetic organic compound characterized by its complex structure, which includes an ester functional group and a ketone moiety. The presence of an azetidine ring indicates that it has potential biological activity, as azetidine derivatives are often explored in medicinal chemistry for their pharmacological properties. The compound features a long carbon chain, contributing to its lipophilicity, which may influence its solubility and permeability in biological systems. Its phenyl group, substituted with an azetidinylmethyl group, suggests potential interactions with biological targets, making it of interest in drug development. The overall molecular structure implies that it may exhibit unique reactivity and stability under various conditions, which can be critical for its application in pharmaceuticals or as a research chemical. Further studies would be necessary to elucidate its specific properties, including its reactivity, stability, and potential biological effects.
Formula:C20H29NO3
InChI:InChI=1/C20H29NO3/c1-2-24-20(23)9-6-4-3-5-8-19(22)18-12-10-17(11-13-18)16-21-14-7-15-21/h10-13H,2-9,14-16H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.