CymitQuimica logo

CAS 898757-36-3

:

ethyl 8-(4-hexylphenyl)-8-oxo-octanoate

Description:
Ethyl 8-(4-hexylphenyl)-8-oxo-octanoate, identified by its CAS number 898757-36-3, is an organic compound characterized by its ester functional group and a complex structure that includes a long hydrocarbon chain and a phenyl group. This compound features an octanoate backbone, which contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. The presence of the 4-hexylphenyl substituent enhances its molecular weight and may influence its physical properties, such as melting and boiling points, as well as its reactivity. Ethyl esters like this one are often used in various applications, including as intermediates in organic synthesis, flavoring agents, or in the production of fragrances. Additionally, the ketone functional group (8-oxo) suggests potential reactivity in oxidation-reduction reactions. Overall, the unique structure of ethyl 8-(4-hexylphenyl)-8-oxo-octanoate positions it as a compound of interest in both industrial and research settings.
Formula:C22H34O3
InChI:InChI=1/C22H34O3/c1-3-5-6-9-12-19-15-17-20(18-16-19)21(23)13-10-7-8-11-14-22(24)25-4-2/h15-18H,3-14H2,1-2H3
SMILES:CCCCCCc1ccc(cc1)C(=O)CCCCCCC(=O)OCC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.