CymitQuimica logo

CAS 898757-38-5

:

1-(4-chloro-2,5-difluoro-phenyl)-3-(1,3-dioxan-2-yl)propan-1-one

Description:
1-(4-chloro-2,5-difluoro-phenyl)-3-(1,3-dioxan-2-yl)propan-1-one, with the CAS number 898757-38-5, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with chlorine and fluorine atoms, as well as a dioxane moiety. The presence of the chloro and difluoro groups suggests that this compound may exhibit unique electronic properties, potentially influencing its reactivity and interactions with biological targets. The dioxan ring contributes to the compound's solubility and stability, making it suitable for various applications in medicinal chemistry and material science. This compound may also possess interesting pharmacological properties, although specific biological activity would require further investigation. Its molecular structure indicates potential for use in drug development, particularly in the design of compounds targeting specific biological pathways. Overall, the characteristics of this compound highlight its potential utility in research and development within the fields of chemistry and pharmacology.
Formula:C13H13ClF2O3
InChI:InChI=1/C13H13ClF2O3/c14-9-7-10(15)8(6-11(9)16)12(17)2-3-13-18-4-1-5-19-13/h6-7,13H,1-5H2
SMILES:C1COC(CCC(=O)c2cc(c(cc2F)Cl)F)OC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.