CAS 898757-60-3
:Ethyl δ-oxo-4-propoxybenzenepentanoate
Description:
Ethyl δ-oxo-4-propoxybenzenepentanoate, identified by its CAS number 898757-60-3, is an organic compound characterized by its ester functional group, which is typical of many compounds in the ester category. This substance features a propoxy group attached to a benzene ring, contributing to its aromatic properties, while the pentanoate portion indicates a five-carbon chain that is part of the ester structure. The presence of a keto group (δ-oxo) suggests that it has a carbonyl functionality, which can influence its reactivity and interactions with other chemical species. Ethyl δ-oxo-4-propoxybenzenepentanoate may exhibit moderate solubility in organic solvents and could participate in various chemical reactions, such as nucleophilic additions or condensation reactions, due to the presence of both the carbonyl and ester functionalities. Its specific applications and behavior in chemical reactions would depend on its molecular structure and the functional groups present, making it of interest in fields such as organic synthesis and medicinal chemistry.
Formula:C16H22O4
InChI:InChI=1S/C16H22O4/c1-3-12-20-14-10-8-13(9-11-14)15(17)6-5-7-16(18)19-4-2/h8-11H,3-7,12H2,1-2H3
InChI key:InChIKey=WJBOVTLRUZWYDG-UHFFFAOYSA-N
SMILES:C(CCCC(OCC)=O)(=O)C1=CC=C(OCCC)C=C1
Synonyms:- Benzenepentanoic acid, δ-oxo-4-propoxy-, ethyl ester
- Ethyl δ-oxo-4-propoxybenzenepentanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.