CymitQuimica logo

CAS 898757-62-5

:

5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-[4′-(trifluoromethyl)[1,1′-biphenyl]-2-yl]-1-pentanone

Description:
5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-[4′-(trifluoromethyl)[1,1′-biphenyl]-2-yl]-1-pentanone, with CAS number 898757-62-5, is a synthetic organic compound characterized by its complex molecular structure, which includes a dioxane ring and a biphenyl moiety with a trifluoromethyl substituent. This compound typically exhibits properties associated with both ketones and aromatic compounds, such as moderate to high boiling points and solubility in organic solvents. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's reactivity and stability. Additionally, the dioxane ring contributes to its potential as a solvent or reagent in various chemical reactions. The compound may be of interest in fields such as medicinal chemistry or materials science due to its unique structural features, which could impart specific biological or physical properties. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses.
Formula:C24H27F3O3
InChI:InChI=1S/C24H27F3O3/c1-23(2)15-29-22(30-16-23)10-6-5-9-21(28)20-8-4-3-7-19(20)17-11-13-18(14-12-17)24(25,26)27/h3-4,7-8,11-14,22H,5-6,9-10,15-16H2,1-2H3
InChI key:InChIKey=VOOYYFLXXFPBNS-UHFFFAOYSA-N
SMILES:C(CCCCC1OCC(C)(C)CO1)(=O)C2=C(C=CC=C2)C3=CC=C(C(F)(F)F)C=C3
Synonyms:
  • 1-Pentanone, 5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-[4′-(trifluoromethyl)[1,1′-biphenyl]-2-yl]-
  • 5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-[4′-(trifluoromethyl)[1,1′-biphenyl]-2-yl]-1-pentanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.