CAS 898757-65-8
:ethyl 7-oxo-7-(4-propoxyphenyl)heptanoate
Description:
Ethyl 7-oxo-7-(4-propoxyphenyl)heptanoate is an organic compound characterized by its ester functional group, which is typical of many compounds in the ester category. This substance features a heptanoate backbone, indicating it has a seven-carbon chain, with a ketone group (7-oxo) and a propoxy-substituted phenyl group at the 7-position. The presence of the propoxy group suggests that the compound may exhibit hydrophobic characteristics, while the ester functionality can influence its solubility in organic solvents. The compound's structure implies potential applications in pharmaceuticals or as an intermediate in organic synthesis, particularly due to the presence of the ketone and aromatic groups, which can participate in various chemical reactions. Additionally, the specific arrangement of functional groups may impart unique biological activities, making it of interest in medicinal chemistry. As with many organic compounds, its physical properties, such as boiling point, melting point, and reactivity, would depend on the molecular interactions and the overall structure.
Formula:C18H26O4
InChI:InChI=1/C18H26O4/c1-3-14-22-16-12-10-15(11-13-16)17(19)8-6-5-7-9-18(20)21-4-2/h10-13H,3-9,14H2,1-2H3
SMILES:CCCOc1ccc(cc1)C(=O)CCCCCC(=O)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.