CymitQuimica logo

CAS 898757-66-9

:

ethyl 2-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)benzoyl]benzoate

Description:
Ethyl 2-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)benzoyl]benzoate, identified by its CAS number 898757-66-9, is a synthetic organic compound characterized by its complex molecular structure, which includes an ethyl ester functional group and a spirocyclic moiety. The presence of the 1,4-dioxa and azaspiro groups suggests potential applications in medicinal chemistry, particularly in drug design, due to their ability to influence biological activity and pharmacokinetics. This compound likely exhibits moderate to high lipophilicity, which can affect its solubility and permeability in biological systems. Additionally, the benzoyl and benzoate groups may contribute to its reactivity and interaction with various biological targets. The compound's unique structure may also impart specific optical properties, making it of interest in materials science or as a potential fluorescent probe. Overall, the characteristics of this compound suggest it could be valuable in various fields, including pharmaceuticals and materials development, although specific biological activity and stability would require further investigation.
Formula:C24H27NO5
InChI:InChI=1/C24H27NO5/c1-2-28-23(27)21-6-4-3-5-20(21)22(26)19-9-7-18(8-10-19)17-25-13-11-24(12-14-25)29-15-16-30-24/h3-10H,2,11-17H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.