CAS 898757-68-1
:ethyl 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)benzoyl]benzoate
Description:
Ethyl 3-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)benzoyl]benzoate, identified by its CAS number 898757-68-1, is a synthetic organic compound characterized by its complex molecular structure, which includes an ethyl ester functional group and a spirocyclic moiety. The presence of the 1,4-dioxa and azaspiro groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their unique structural properties that may influence biological activity. The compound likely exhibits moderate to high lipophilicity, which can affect its solubility and permeability in biological systems. Additionally, the presence of aromatic rings may contribute to its stability and reactivity, making it a candidate for further studies in drug design and development. Its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. As with many compounds of this nature, understanding its pharmacokinetics and pharmacodynamics would be essential for evaluating its potential therapeutic applications.
Formula:C24H27NO5
InChI:InChI=1/C24H27NO5/c1-2-28-23(27)21-5-3-4-20(16-21)22(26)19-8-6-18(7-9-19)17-25-12-10-24(11-13-25)29-14-15-30-24/h3-9,16H,2,10-15,17H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.