CAS 898757-74-9

[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-(4-methylsulfanylphenyl)methanone

Description:

The chemical substance with the name "[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-(4-methylsulfanylphenyl)methanone" and CAS number 898757-74-9 is a complex organic compound characterized by its unique structural features. It contains a spirocyclic moiety, which contributes to its three-dimensional shape and may influence its biological activity. The presence of a methanone functional group indicates that it has ketone characteristics, which can affect its reactivity and interactions with other molecules. Additionally, the compound features both phenyl and methylsulfanyl groups, which can enhance its lipophilicity and potentially influence its solubility in organic solvents. The dioxane and azaspiro components suggest potential applications in medicinal chemistry, particularly in drug design, due to their ability to interact with biological targets. Overall, this compound's intricate structure may confer specific pharmacological properties, making it of interest for further research in various chemical and biological contexts.

Formula: C₂₂H₂₅NO₃S

InChI: InChI=1/C22H25NO3S/c1-27-20-8-6-19(7-9-20)21(24)18-4-2-17(3-5-18)16-23-12-10-22(11-13-23)25-14-15-26-22/h2-9H,10-16H2,1H3

SMILES: CSc1ccc(cc1)C(=O)c1ccc(cc1)CN1CCC2(CC1)OCCO2

4′-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]-4-thiomethyl benzophenone

CAS: 898757-74-9

Formula: C₂₂H₂₅NO₃S

Purity: 97.0%

Molecular weight: 383.51

Ref: 10-F204441