CAS 898757-76-1
:(3-bromophenyl)-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone
Description:
The chemical substance known as (3-bromophenyl)-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone, with the CAS number 898757-76-1, is a complex organic compound characterized by its unique structural features. It contains a bromophenyl group, which contributes to its potential reactivity and biological activity. The presence of a spirocyclic structure, specifically the 1,4-dioxa-8-azaspiro framework, suggests interesting conformational properties and may influence its interaction with biological targets. The methanone functional group indicates that it is a ketone, which can participate in various chemical reactions, including nucleophilic attacks. This compound may exhibit specific pharmacological properties due to its structural motifs, making it a candidate for research in medicinal chemistry. Additionally, the presence of heteroatoms such as nitrogen and oxygen in the spirocyclic moiety may enhance its solubility and bioavailability. Overall, this compound's intricate structure and functional groups suggest potential applications in drug development and materials science.
Formula:C21H22BrNO3
InChI:InChI=1/C21H22BrNO3/c22-19-3-1-2-18(14-19)20(24)17-6-4-16(5-7-17)15-23-10-8-21(9-11-23)25-12-13-26-21/h1-7,14H,8-13,15H2
Synonyms:- (4-((1,4-Dioxa-8-azaspiro[4.5]Decan-8-yl)methyl)phenyl)(3-bromophenyl)methanone
- 3-BROMO-4'-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]BENZOPHENONE
- Methanone, (3-bromophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.