CymitQuimica logo

CAS 898757-77-2

:

ethyl 8-(4-isopropoxyphenyl)-8-oxo-octanoate

Description:
Ethyl 8-(4-isopropoxyphenyl)-8-oxo-octanoate, identified by its CAS number 898757-77-2, is an organic compound characterized by its ester functional group and a complex structure that includes a phenyl ring substituted with an isopropoxy group. This compound features a long carbon chain, specifically an octanoate moiety, which contributes to its hydrophobic properties. The presence of the keto group (8-oxo) indicates that it has a carbonyl functionality, which can influence its reactivity and potential applications in organic synthesis or as a pharmaceutical intermediate. Ethyl esters like this one are often used in the synthesis of various bioactive compounds due to their ability to undergo hydrolysis to yield corresponding acids. The isopropoxy substitution on the phenyl ring may enhance the compound's lipophilicity, potentially affecting its biological activity and solubility in organic solvents. Overall, this compound's unique structure suggests it may have applications in medicinal chemistry or as a building block in the synthesis of more complex molecules.
Formula:C19H28O4
InChI:InChI=1/C19H28O4/c1-4-22-19(21)10-8-6-5-7-9-18(20)16-11-13-17(14-12-16)23-15(2)3/h11-15H,4-10H2,1-3H3
SMILES:CCOC(=O)CCCCCCC(=O)c1ccc(cc1)OC(C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.