CAS 898757-78-3

Methanone, (4-bromophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:

Methanone, (4-bromophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique structural features, including a methanone functional group and a spirocyclic structure. The presence of a bromine atom on the phenyl ring contributes to its reactivity and potential applications in medicinal chemistry. The compound also contains a dioxa and azaspiro moiety, which may influence its biological activity and solubility properties. Typically, such compounds are studied for their potential pharmacological effects, including antitumor or antimicrobial activities. The molecular structure suggests that it may exhibit interesting interactions with biological targets due to its multiple functional groups. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of the bromine atom and the spirocyclic framework. Overall, this compound represents a class of organic molecules that may have significant implications in drug development and materials science.

Formula: C₂₁H₂₂BrNO₃

InChI: InChI=1S/C21H22BrNO3/c22-19-7-5-18(6-8-19)20(24)17-3-1-16(2-4-17)15-23-11-9-21(10-12-23)25-13-14-26-21/h1-8H,9-15H2

InChI key: InChIKey=ZXSGQTRKIKJMDY-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=CC=C(C(=O)C4=CC=C(Br)C=C4)C=C3

Synonyms:

• (4-Bromophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone
• Methanone, (4-bromophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-