CAS 898757-85-2
:ethyl 8-oxo-8-(4-pentoxyphenyl)octanoate
Description:
Ethyl 8-oxo-8-(4-pentoxyphenyl)octanoate, identified by its CAS number 898757-85-2, is an organic compound characterized by its ester functional group and a complex structure that includes a ketone and an aromatic ring. This compound features a long carbon chain, which contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. The presence of the 4-pentoxyphenyl group introduces additional steric and electronic effects, potentially influencing its reactivity and interactions with other molecules. Ethyl 8-oxo-8-(4-pentoxyphenyl)octanoate may exhibit interesting biological activities, making it a candidate for research in pharmaceuticals or agrochemicals. Its unique structure suggests potential applications in various fields, including materials science and organic synthesis. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be evaluated through further studies.
Formula:C21H32O4
InChI:InChI=1/C21H32O4/c1-3-5-10-17-25-19-15-13-18(14-16-19)20(22)11-8-6-7-9-12-21(23)24-4-2/h13-16H,3-12,17H2,1-2H3
SMILES:CCCCCOc1ccc(cc1)C(=O)CCCCCCC(=O)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.