CAS 898757-91-0
:ethyl 6-(4-hexoxyphenyl)-6-oxo-hexanoate
Description:
Ethyl 6-(4-hexoxyphenyl)-6-oxo-hexanoate, identified by its CAS number 898757-91-0, is an organic compound characterized by its ester functional group, which is typical of ethyl esters. This compound features a hexanoate backbone, indicating a six-carbon chain, and a ketone group (6-oxo) that contributes to its reactivity and potential applications in organic synthesis. The presence of the 4-hexoxyphenyl substituent suggests that it has aromatic characteristics, which can influence its solubility and interaction with other chemical species. The hexoxy group enhances the hydrophobic nature of the molecule, potentially affecting its physical properties such as boiling point and solubility in organic solvents. Ethyl 6-(4-hexoxyphenyl)-6-oxo-hexanoate may be of interest in various fields, including pharmaceuticals and materials science, due to its structural features that could facilitate specific chemical reactions or interactions. However, detailed studies on its biological activity, toxicity, and specific applications would be necessary to fully understand its potential uses.
Formula:C20H30O4
InChI:InChI=1/C20H30O4/c1-3-5-6-9-16-24-18-14-12-17(13-15-18)19(21)10-7-8-11-20(22)23-4-2/h12-15H,3-11,16H2,1-2H3
SMILES:CCCCCCOc1ccc(cc1)C(=O)CCCCC(=O)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.