CAS 898757-96-5

Methanone, (3,4-dimethylphenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:

Methanone, (3,4-dimethylphenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique structural features, which include a methanone functional group and a spirocyclic structure. The presence of the 3,4-dimethylphenyl group indicates that it has two methyl substituents on a phenyl ring, contributing to its hydrophobic characteristics. The compound also contains a 1,4-dioxa moiety, which introduces oxygen atoms into the structure, potentially affecting its reactivity and solubility. The spirocyclic element, specifically the 8-azaspiro structure, suggests that the compound may exhibit interesting conformational properties and biological activity. Such compounds are often investigated for their potential applications in pharmaceuticals or as intermediates in organic synthesis. The molecular complexity and the presence of multiple functional groups can lead to diverse interactions with biological systems, making it a subject of interest in medicinal chemistry. Overall, this compound exemplifies the intricate nature of organic molecules and their potential utility in various chemical applications.

Formula: C₂₃H₂₇NO₃

InChI: InChI=1S/C23H27NO3/c1-17-3-6-21(15-18(17)2)22(25)20-7-4-19(5-8-20)16-24-11-9-23(10-12-24)26-13-14-27-23/h3-8,15H,9-14,16H2,1-2H3

InChI key: InChIKey=YCBQLPPQIKUZLF-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=CC=C(C(=O)C4=CC(C)=C(C)C=C4)C=C3

Synonyms:

• Methanone, (3,4-dimethylphenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

3,4-dimethyl-4′-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]benzophenone

CAS: 898757-96-5

Formula: C₂₃H₂₇NO₃

Purity: 97.0%

Molecular weight: 365.473

Ref: 10-F204452