CAS 898757-98-7

Methanone, (3,5-dimethylphenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:

Methanone, (3,5-dimethylphenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique structural features, including a methanone functional group and a spirocyclic structure. The presence of the 3,5-dimethylphenyl group indicates that it has two methyl substituents on a phenyl ring, which can influence its physical and chemical properties, such as solubility and reactivity. The compound also contains a dioxa and azaspiro moiety, suggesting potential applications in medicinal chemistry, particularly in drug design, due to the spirocyclic structure that can enhance biological activity. Its molecular architecture may contribute to specific interactions with biological targets, making it of interest in pharmacological studies. Additionally, the presence of multiple functional groups may lead to diverse reactivity patterns, allowing for potential modifications and derivatizations. Overall, this compound exemplifies the complexity and diversity found in organic chemistry, particularly in the realm of synthetic and medicinal compounds.

Formula: C₂₃H₂₇NO₃

InChI: InChI=1S/C23H27NO3/c1-17-13-18(2)15-21(14-17)22(25)20-5-3-19(4-6-20)16-24-9-7-23(8-10-24)26-11-12-27-23/h3-6,13-15H,7-12,16H2,1-2H3

InChI key: InChIKey=JMKWMPXEUAXOKV-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=CC=C(C(=O)C4=CC(C)=CC(C)=C4)C=C3

Synonyms:

• (3,5-Dimethylphenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone
• Methanone, (3,5-dimethylphenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

3,5-dimethyl-4′-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]benzophenone

CAS: 898757-98-7

Formula: C₂₃H₂₇NO₃

Purity: 97.0%

Molecular weight: 365.473

Ref: 10-F204453