CymitQuimica logo

CAS 898758-00-4

:

(4-bromo-3-fluoro-phenyl)-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone

Description:
The chemical substance known as (4-bromo-3-fluoro-phenyl)-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone, with the CAS number 898758-00-4, is a complex organic compound characterized by its unique structural features. It contains a phenyl ring substituted with bromine and fluorine atoms, which can influence its reactivity and biological activity. The presence of a spirocyclic structure, specifically the 1,4-dioxa-8-azaspiro[4.5]decan moiety, suggests potential applications in medicinal chemistry, particularly in drug design, due to its ability to interact with biological targets. The methanone functional group indicates that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Additionally, the compound's molecular structure may confer specific pharmacokinetic properties, such as solubility and permeability, which are critical for therapeutic efficacy. Overall, this compound exemplifies the complexity and diversity of organic molecules, with potential implications in various fields, including pharmaceuticals and materials science.
Formula:C21H21BrFNO3
InChI:InChI=1/C21H21BrFNO3/c22-18-6-5-17(13-19(18)23)20(25)16-3-1-15(2-4-16)14-24-9-7-21(8-10-24)26-11-12-27-21/h1-6,13H,7-12,14H2
SMILES:c1cc(ccc1CN1CCC2(CC1)OCCO2)C(=O)c1ccc(c(c1)F)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.