CAS 898758-10-6

Methanone, [4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl][2-(trifluoromethyl)phenyl]-

Description:

Methanone, specifically the compound with the name "4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl][2-(trifluoromethyl)phenyl]-" and CAS number 898758-10-6, is a complex organic molecule characterized by its unique structural features. It contains a methanone functional group, which is indicative of a ketone, and is further substituted with a spirocyclic structure that includes a dioxane and an azaspiro moiety. The presence of a trifluoromethyl group on one of the phenyl rings enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit interesting chemical reactivity due to the presence of multiple functional groups, making it a candidate for various applications in medicinal chemistry or materials science. Its specific properties, such as solubility, melting point, and reactivity, would depend on the overall molecular structure and the interactions between its functional groups. Further studies would be necessary to elucidate its potential uses and biological effects.

Formula: C₂₂H₂₂F₃NO₃

InChI: InChI=1S/C22H22F3NO3/c23-22(24,25)19-4-2-1-3-18(19)20(27)17-7-5-16(6-8-17)15-26-11-9-21(10-12-26)28-13-14-29-21/h1-8H,9-15H2

InChI key: InChIKey=ZPMHLFTWQZINBP-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=CC=C(C(=O)C4=C(C(F)(F)F)C=CC=C4)C=C3

Synonyms:

• [4-(1,4-Dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl][2-(trifluoromethyl)phenyl]methanone
• Methanone, [4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl][2-(trifluoromethyl)phenyl]-