CAS 898758-12-8

Methanone, [4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl][3-(trifluoromethyl)phenyl]-

Description:

Methanone, specifically the compound with the name "[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl][3-(trifluoromethyl)phenyl]-" and CAS number 898758-12-8, is a complex organic molecule characterized by its unique structural features. It contains a methanone functional group, which is indicative of a ketone, and incorporates a spirocyclic structure that includes a dioxane and azaspiro moiety. The presence of a trifluoromethyl group on one of the phenyl rings enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit interesting chemical properties due to its diverse functional groups, which can affect its reactivity, solubility, and potential applications in pharmaceuticals or materials science. Additionally, the presence of fluorine atoms typically imparts unique electronic properties, making such compounds valuable in medicinal chemistry for drug design. Overall, the characteristics of this compound suggest it may have significant implications in various chemical and biological contexts.

Formula: C₂₂H₂₂F₃NO₃

InChI: InChI=1S/C22H22F3NO3/c23-22(24,25)19-3-1-2-18(14-19)20(27)17-6-4-16(5-7-17)15-26-10-8-21(9-11-26)28-12-13-29-21/h1-7,14H,8-13,15H2

InChI key: InChIKey=YGKIKKBNKLZFLM-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=CC=C(C(=O)C4=CC(C(F)(F)F)=CC=C4)C=C3

Synonyms:

• Methanone, [4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl][3-(trifluoromethyl)phenyl]-
• [4-(1,4-Dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl][3-(trifluoromethyl)phenyl]methanone