CAS 898758-14-0
:[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone
Description:
The chemical substance known as [4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone, with the CAS number 898758-14-0, is characterized by its complex molecular structure, which includes a spirocyclic moiety and a trifluoromethyl group. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of aromatic rings and the trifluoromethyl group, which can enhance its biological activity and solubility in organic solvents. The presence of the dioxane and azaspiro structures may contribute to unique conformational characteristics and potential interactions with biological targets. Additionally, the compound may display interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its synthesis and reactivity can be influenced by the functional groups present, and it may undergo various chemical transformations under specific conditions. Overall, this compound represents a class of organic molecules with potential applications in drug development and material science.
Formula:C22H22F3NO3
InChI:InChI=1/C22H22F3NO3/c23-22(24,25)19-7-5-18(6-8-19)20(27)17-3-1-16(2-4-17)15-26-11-9-21(10-12-26)28-13-14-29-21/h1-8H,9-15H2
SMILES:c1cc(ccc1CN1CCC2(CC1)OCCO2)C(=O)c1ccc(cc1)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.