CAS 898758-16-2
:(4-bromo-2-fluoro-phenyl)-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone
Description:
The chemical substance known as (4-bromo-2-fluoro-phenyl)-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone, with the CAS number 898758-16-2, is a complex organic compound characterized by its unique structural features. It contains a phenyl ring substituted with both bromine and fluorine atoms, which can influence its reactivity and biological activity. The presence of a spirocyclic structure, specifically the 1,4-dioxa-8-azaspiro[4.5]decan moiety, suggests potential applications in medicinal chemistry, as spiro compounds often exhibit interesting pharmacological properties. The methanone functional group indicates that the compound may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Overall, this compound's intricate structure may contribute to its potential utility in drug development or as a research tool in organic synthesis, although specific biological activity and properties would require further investigation through empirical studies.
Formula:C21H21BrFNO3
InChI:InChI=1/C21H21BrFNO3/c22-17-5-6-18(19(23)13-17)20(25)16-3-1-15(2-4-16)14-24-9-7-21(8-10-24)26-11-12-27-21/h1-6,13H,7-12,14H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.