CAS 898758-18-4

2-Pyridinyl(3,4,5-trifluorophenyl)methanone

Description:

2-Pyridinyl(3,4,5-trifluorophenyl)methanone is an organic compound characterized by its unique structure, which includes a pyridine ring and a trifluorophenyl group. The presence of the pyridine moiety contributes to its potential as a heterocyclic compound, often influencing its reactivity and interaction with biological systems. The trifluorophenyl group, with three fluorine atoms substituted on the aromatic ring, enhances the compound's lipophilicity and may improve its binding affinity in various chemical reactions or biological targets. This compound is likely to exhibit significant polar characteristics due to the electronegative fluorine atoms, which can affect its solubility and stability in different solvents. Additionally, the ketone functional group (methanone) introduces reactivity that can be exploited in synthetic applications. Overall, 2-Pyridinyl(3,4,5-trifluorophenyl)methanone is of interest in medicinal chemistry and material science, where its unique properties may be harnessed for developing new pharmaceuticals or advanced materials.

Formula: C₁₂H₆F₃NO

InChI: InChI=1S/C12H6F3NO/c13-8-5-7(6-9(14)11(8)15)12(17)10-3-1-2-4-16-10/h1-6H

InChI key: InChIKey=XOGWJLNARSFIQQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(F)C(F)=C1)C2=CC=CC=N2

Synonyms:

• 2-Pyridinyl(3,4,5-trifluorophenyl)methanone
• Methanone, 2-Pyridinyl(3,4,5-Trifluorophenyl)-
• Pyridin-2-yl(3,4,5-trifluorophenyl)methanone

2-(3,4,5-Trifluorobenzoyl)pyridine

CAS: 898758-18-4

Formula: C₁₂H₆F₃NO

Purity: 97.0%

Molecular weight: 237.181

Ref: 10-F202587