CAS 898758-20-8
:Ethyl 2,4-dimethoxy-ζ-oxobenzeneheptanoate
Description:
Ethyl 2,4-dimethoxy-ζ-oxobenzeneheptanoate, identified by its CAS number 898758-20-8, is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a benzene ring substituted with two methoxy groups at the 2 and 4 positions, contributing to its unique chemical properties and potential reactivity. The presence of the heptanoate chain indicates a seven-carbon aliphatic chain, which can influence its solubility and hydrophobic characteristics. The oxo group in the structure suggests the presence of a carbonyl functionality, which may enhance its reactivity in various chemical reactions, such as nucleophilic additions or condensation reactions. Ethyl 2,4-dimethoxy-ζ-oxobenzeneheptanoate may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry or as a potential intermediate in organic synthesis. Its specific physical and chemical properties, such as boiling point, melting point, and solubility, would require experimental determination or detailed literature references for precise characterization.
Formula:C17H24O5
InChI:InChI=1/C17H24O5/c1-4-22-17(19)9-7-5-6-8-15(18)14-11-10-13(20-2)12-16(14)21-3/h10-12H,4-9H2,1-3H3
InChI key:InChIKey=MPGHKLILYFOSPV-UHFFFAOYSA-N
SMILES:C(CCCCCC(OCC)=O)(=O)C1=C(OC)C=C(OC)C=C1
Synonyms:- Ethyl 2,4-dimethoxy-ζ-oxobenzeneheptanoate
- Benzeneheptanoic acid, 2,4-dimethoxy-ζ-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.