CAS 898758-23-1
:ethyl 8-(2,4-dimethoxyphenyl)-8-oxo-octanoate
Description:
Ethyl 8-(2,4-dimethoxyphenyl)-8-oxo-octanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethyl alcohol) and a carboxylic acid. This compound features a long carbon chain, specifically an octanoate structure, which contributes to its hydrophobic properties. The presence of the 2,4-dimethoxyphenyl group indicates that it has aromatic characteristics, likely influencing its reactivity and solubility. The ketone functional group (8-oxo) suggests that it may participate in various chemical reactions, such as nucleophilic additions or reductions. Ethyl 8-(2,4-dimethoxyphenyl)-8-oxo-octanoate may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C18H26O5
InChI:InChI=1/C18H26O5/c1-4-23-18(20)10-8-6-5-7-9-16(19)15-12-11-14(21-2)13-17(15)22-3/h11-13H,4-10H2,1-3H3
SMILES:CCOC(=O)CCCCCCC(=O)c1ccc(cc1OC)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.