CAS 898758-28-6

Methanone, (2,3-dichlorophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:

Methanone, (2,3-dichlorophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique structural features. It contains a methanone functional group, which is indicative of a ketone, and is substituted with a dichlorophenyl group, suggesting the presence of chlorine atoms that can influence its reactivity and physical properties. The compound also features a spirocyclic structure, which contributes to its three-dimensional conformation and may affect its biological activity. The presence of the dioxane moiety indicates potential solubility in polar solvents, while the azaspiro component suggests possible interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its molecular structure and substituents can significantly influence its stability, reactivity, and potential applications in various fields, including pharmaceuticals and agrochemicals. As with many complex organic compounds, understanding its characteristics requires detailed analysis through techniques such as NMR, mass spectrometry, and X-ray crystallography.

Formula: C₂₁H₂₁Cl₂NO₃

InChI: InChI=1S/C21H21Cl2NO3/c22-18-3-1-2-17(19(18)23)20(25)16-6-4-15(5-7-16)14-24-10-8-21(9-11-24)26-12-13-27-21/h1-7H,8-14H2

InChI key: InChIKey=OKDXCZDYWAZOHF-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=CC=C(C(=O)C4=C(Cl)C(Cl)=CC=C4)C=C3

Synonyms:

• (2,3-Dichlorophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone
• Methanone, (2,3-dichlorophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-