CAS 898758-29-7
:ethyl 5-(2,5-dimethoxyphenyl)-5-oxo-pentanoate
Description:
Ethyl 5-(2,5-dimethoxyphenyl)-5-oxo-pentanoate, identified by its CAS number 898758-29-7, is an organic compound characterized by its ester functional group and a complex aromatic structure. This compound features a pentanoate backbone, which includes a five-carbon chain with a ketone group at the fifth position, contributing to its reactivity and potential applications in organic synthesis. The presence of the 2,5-dimethoxyphenyl group enhances its aromatic properties, likely influencing its solubility and interaction with other chemical species. Ethyl esters, in general, are known for their pleasant odors and are often used in flavoring and fragrance applications. Additionally, the methoxy groups on the aromatic ring can affect the compound's electronic properties, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, this compound's unique structure may offer interesting pathways for research in medicinal chemistry and materials science.
Formula:C15H20O5
InChI:InChI=1/C15H20O5/c1-4-20-15(17)7-5-6-13(16)12-10-11(18-2)8-9-14(12)19-3/h8-10H,4-7H2,1-3H3
SMILES:CCOC(=O)CCCC(=O)c1cc(ccc1OC)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.