CAS 898758-31-1

Methanone, (2,4-dichlorophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:

Methanone, (2,4-dichlorophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of dichlorophenyl groups indicates that the compound has chlorine substituents, which can influence its reactivity and biological activity. The spirocyclic structure, featuring a dioxane and azaspiro moiety, suggests potential applications in medicinal chemistry, particularly in drug design, due to its ability to interact with biological targets. The compound's molecular weight, solubility, and stability would depend on its specific functional groups and overall structure. Additionally, the presence of heteroatoms such as nitrogen and oxygen may impart specific properties, such as increased polarity or hydrogen bonding capabilities. Overall, this compound exemplifies the complexity often found in synthetic organic chemistry, with potential implications in various fields, including pharmaceuticals and materials science.

Formula: C₂₁H₂₁Cl₂NO₃

InChI: InChI=1S/C21H21Cl2NO3/c22-17-5-6-18(19(23)13-17)20(25)16-3-1-15(2-4-16)14-24-9-7-21(8-10-24)26-11-12-27-21/h1-6,13H,7-12,14H2

InChI key: InChIKey=IFUVSYOGLPWNGE-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=CC=C(C(=O)C4=C(Cl)C=C(Cl)C=C4)C=C3

Synonyms:

• (2,4-Dichlorophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone
• Methanone, (2,4-dichlorophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-