CAS 898758-34-4
:(2,5-dichlorophenyl)-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone
Description:
The chemical substance known as (2,5-dichlorophenyl)-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone, with the CAS number 898758-34-4, is a complex organic compound characterized by its unique structural features. It contains a dichlorophenyl group, which contributes to its potential biological activity, and a spirocyclic structure that includes a dioxane and azaspiro moiety, suggesting interesting steric and electronic properties. The presence of the methanone functional group indicates that it may exhibit reactivity typical of ketones, such as nucleophilic addition. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, possibly acting as a scaffold for drug development. Its solubility, stability, and reactivity would depend on the specific functional groups and their interactions within biological systems. Overall, this compound represents a class of molecules that could be explored for various applications, including therapeutic agents or chemical probes in research.
Formula:C21H21Cl2NO3
InChI:InChI=1/C21H21Cl2NO3/c22-17-5-6-19(23)18(13-17)20(25)16-3-1-15(2-4-16)14-24-9-7-21(8-10-24)26-11-12-27-21/h1-6,13H,7-12,14H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.