CAS 898758-36-6

1-oxazol-2-yloctan-1-one

Description:

1-Oxazol-2-yloctan-1-one, with the CAS number 898758-36-6, is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features an octanoyl chain, indicating it has a long hydrocarbon tail, which contributes to its hydrophobic properties. The presence of the oxazole moiety suggests potential biological activity, as heterocycles are often found in pharmaceuticals and agrochemicals. The compound may exhibit moderate solubility in organic solvents, while its solubility in water could be limited due to the hydrophobic octanoyl group. Additionally, the structure implies that it may participate in various chemical reactions typical of carbonyl compounds, such as nucleophilic addition or condensation reactions. Its specific applications and reactivity would depend on the functional groups present and the overall molecular structure, making it of interest in synthetic organic chemistry and potentially in medicinal chemistry for developing new therapeutic agents.

Formula: C₁₁H₁₇NO₂

InChI: InChI=1/C11H17NO2/c1-2-3-4-5-6-7-10(13)11-12-8-9-14-11/h8-9H,2-7H2,1H3

SMILES: CCCCCCCC(=O)c1ncco1

Synonyms:

• 2-OCTANOYLOXAZOLE
• 1-(Oxazol-2-yl)octan-1-one
• 1-Octanone, 1-(2-oxazolyl)-