CymitQuimica logo

CAS 898758-37-7

:

Methanone, (3,4-dichlorophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-

Description:
Methanone, (3,4-dichlorophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]- is a complex organic compound characterized by its unique structural features, including a methanone functional group and a spirocyclic structure. The presence of dichlorophenyl groups indicates that the compound has two chlorine atoms substituted on a phenyl ring, which can influence its reactivity and biological activity. The spirocyclic moiety, specifically the 1,4-dioxa-8-azaspiro structure, suggests potential applications in medicinal chemistry, as spiro compounds often exhibit interesting pharmacological properties. The compound's molecular structure may contribute to its solubility, stability, and interaction with biological targets. Additionally, the presence of heteroatoms like nitrogen and oxygen in the structure can enhance its potential for forming hydrogen bonds, which is significant in drug design and development. Overall, this compound's unique characteristics make it a subject of interest for further research, particularly in the fields of organic synthesis and pharmaceutical applications.
Formula:C21H21Cl2NO3
InChI:InChI=1S/C21H21Cl2NO3/c22-18-6-5-17(13-19(18)23)20(25)16-3-1-15(2-4-16)14-24-9-7-21(8-10-24)26-11-12-27-21/h1-6,13H,7-12,14H2
InChI key:InChIKey=OWPLDSHHSJVBQJ-UHFFFAOYSA-N
SMILES:C(N1CCC2(CC1)OCCO2)C3=CC=C(C(=O)C4=CC(Cl)=C(Cl)C=C4)C=C3
Synonyms:
  • (3,4-Dichlorophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]methanone
  • Methanone, (3,4-dichlorophenyl)[4-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.