CymitQuimica logo

CAS 898758-39-9

:

1-(2-Oxazolyl)-1-nonanone

Description:
1-(2-Oxazolyl)-1-nonanone, identified by its CAS number 898758-39-9, is an organic compound characterized by the presence of a nonanone backbone and a 2-oxazolyl group. This compound typically exhibits a moderate molecular weight and is classified as a ketone due to the presence of the carbonyl functional group (C=O) within its structure. The oxazole ring contributes to its heterocyclic nature, which can influence its reactivity and interaction with other chemical species. Generally, compounds like 1-(2-Oxazolyl)-1-nonanone may display properties such as solubility in organic solvents, potential biological activity, and the ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. The presence of both aliphatic and heterocyclic components in its structure may also impart unique characteristics, such as specific melting and boiling points, as well as distinct spectral properties in techniques like NMR and IR spectroscopy. Overall, this compound's unique structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research and characterization.
Formula:C12H19NO2
InChI:InChI=1S/C12H19NO2/c1-2-3-4-5-6-7-8-11(14)12-13-9-10-15-12/h9-10H,2-8H2,1H3
InChI key:InChIKey=TYIRJAPUCIYUKV-UHFFFAOYSA-N
SMILES:C(CCCCCCCC)(=O)C1=NC=CO1
Synonyms:
  • 1-Nonanone, 1-(2-oxazolyl)-
  • 1-(2-Oxazolyl)-1-nonanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.