CAS 898758-40-2
:(3,5-dichlorophenyl)-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone
Description:
The chemical substance known as (3,5-dichlorophenyl)-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)phenyl]methanone, with the CAS number 898758-40-2, is a complex organic compound characterized by its unique structural features. It contains a dichlorophenyl group, which contributes to its potential biological activity, and a spirocyclic structure that includes a dioxane and azaspiro moiety, indicating potential for diverse interactions in biological systems. The presence of multiple functional groups suggests that this compound may exhibit interesting pharmacological properties, possibly acting as a ligand or inhibitor in various biochemical pathways. Its molecular structure implies potential solubility in organic solvents, while the presence of chlorine atoms may influence its reactivity and stability. Additionally, the compound's intricate design may allow for specific interactions with target proteins or enzymes, making it a candidate for further investigation in medicinal chemistry or drug development. Overall, this compound exemplifies the complexity and diversity found in synthetic organic chemistry, particularly in the context of developing new therapeutic agents.
Formula:C21H21Cl2NO3
InChI:InChI=1/C21H21Cl2NO3/c22-18-11-17(12-19(23)13-18)20(25)16-3-1-15(2-4-16)14-24-7-5-21(6-8-24)26-9-10-27-21/h1-4,11-13H,5-10,14H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.