CAS 898758-41-3
:Ethyl 2,6-dimethoxy-γ-oxobenzenebutanoate
Description:
Ethyl 2,6-dimethoxy-γ-oxobenzenebutanoate, identified by its CAS number 898758-41-3, is an organic compound characterized by its ester functional group and a complex aromatic structure. This substance features a butanoate backbone, which is linked to a benzene ring that is further substituted with two methoxy groups at the 2 and 6 positions, contributing to its unique chemical properties. The presence of the γ-oxo group indicates that it contains a ketone functionality, which can influence its reactivity and interactions with other chemical species. Ethyl 2,6-dimethoxy-γ-oxobenzenebutanoate is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic components. Its structural features suggest potential applications in organic synthesis, pharmaceuticals, or as a building block in the development of more complex molecules. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of appropriate personal protective equipment.
Formula:C14H18O5
InChI:InChI=1S/C14H18O5/c1-4-19-13(16)9-8-10(15)14-11(17-2)6-5-7-12(14)18-3/h5-7H,4,8-9H2,1-3H3
InChI key:InChIKey=UUAGTIVZCXDVCE-UHFFFAOYSA-N
SMILES:C(CCC(OCC)=O)(=O)C1=C(OC)C=CC=C1OC
Synonyms:- Benzenebutanoic acid, 2,6-dimethoxy-γ-oxo-, ethyl ester
- Ethyl 2,6-dimethoxy-γ-oxobenzenebutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.