CAS 898758-45-7
:1-(2-Oxazolyl)-1-undecanone
Description:
1-(2-Oxazolyl)-1-undecanone, identified by its CAS number 898758-45-7, is a chemical compound characterized by the presence of an oxazole ring and a long aliphatic chain. The oxazole moiety contributes to its potential biological activity, as oxazoles are known for their roles in various pharmacological applications. The undecanone part of the molecule indicates that it has a carbon chain of eleven carbon atoms, which can influence its solubility and lipophilicity, making it more likely to interact with biological membranes. This compound may exhibit properties such as antimicrobial or antifungal activity, although specific biological effects would depend on its structural conformation and the presence of functional groups. Additionally, its molecular structure suggests it may be used in organic synthesis or as an intermediate in the production of other chemical entities. Overall, 1-(2-Oxazolyl)-1-undecanone represents a class of compounds that could be of interest in medicinal chemistry and materials science.
Formula:C14H23NO2
InChI:InChI=1S/C14H23NO2/c1-2-3-4-5-6-7-8-9-10-13(16)14-15-11-12-17-14/h11-12H,2-10H2,1H3
InChI key:InChIKey=ZXRINHMDCFEPIR-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCC)(=O)C1=NC=CO1
Synonyms:- 1-Undecanone, 1-(2-oxazolyl)-
- 1-(2-Oxazolyl)-1-undecanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.