CAS 898758-48-0
:1-oxazol-2-yldodecan-1-one
Description:
1-Oxazol-2-yldodecan-1-one, identified by its CAS number 898758-48-0, is a chemical compound characterized by its oxazole ring and a long aliphatic chain. The oxazole moiety contributes to its potential reactivity and biological activity, as heterocycles often exhibit unique properties due to their nitrogen and oxygen atoms. The presence of the dodecan-1-one structure indicates that it has a long hydrocarbon chain, which can influence its solubility, melting point, and overall hydrophobicity. This compound may exhibit interesting properties in various applications, including pharmaceuticals, agrochemicals, or materials science, due to the combination of its functional groups. Additionally, the presence of the carbonyl group (ketone) suggests potential for further chemical reactivity, such as nucleophilic attacks or condensation reactions. Overall, 1-oxazol-2-yldodecan-1-one represents a versatile structure that could be explored for various synthetic and practical applications in chemistry.
Formula:C15H25NO2
InChI:InChI=1/C15H25NO2/c1-2-3-4-5-6-7-8-9-10-11-14(17)15-16-12-13-18-15/h12-13H,2-11H2,1H3
SMILES:CCCCCCCCCCCC(=O)c1ncco1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.