CAS 898758-51-5

1-(2-Oxazolyl)-1-tridecanone

Description:

1-(2-Oxazolyl)-1-tridecanone is an organic compound characterized by its oxazole ring and a long-chain aliphatic ketone. The presence of the oxazole moiety contributes to its potential biological activity, as heterocycles often exhibit interesting pharmacological properties. The tridecanone portion indicates that the compound has a long hydrophobic carbon chain, which can influence its solubility, volatility, and interaction with biological membranes. This compound is likely to be a solid or viscous liquid at room temperature, depending on its specific structural conformation and intermolecular interactions. Its molecular structure suggests potential applications in fields such as pharmaceuticals, agrochemicals, or as a flavoring agent, although specific applications would depend on further research into its properties and reactivity. Additionally, the presence of both polar and non-polar functional groups may allow for diverse interactions in various chemical environments, making it a compound of interest for synthetic and medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₆H₂₇NO₂

InChI: InChI=1S/C16H27NO2/c1-2-3-4-5-6-7-8-9-10-11-12-15(18)16-17-13-14-19-16/h13-14H,2-12H2,1H3

InChI key: InChIKey=ASCDMTJLKMAUPY-UHFFFAOYSA-N

SMILES: C(CCCCCCCCCCCC)(=O)C1=NC=CO1

Synonyms:

• 1-Tridecanone, 1-(2-oxazolyl)-
• 1-(2-Oxazolyl)-1-tridecanone