CAS 898758-67-3
:ethyl 7-(3,5-dimethoxyphenyl)-7-oxo-heptanoate
Description:
Ethyl 7-(3,5-dimethoxyphenyl)-7-oxo-heptanoate, identified by its CAS number 898758-67-3, is an organic compound characterized by its ester functional group and a heptanoate backbone. The presence of the 3,5-dimethoxyphenyl substituent indicates that it has two methoxy groups attached to a phenyl ring, which can influence its solubility and reactivity. This compound is likely to exhibit moderate lipophilicity due to the long carbon chain and aromatic structure, making it soluble in organic solvents while having limited solubility in water. The ketone functional group (7-oxo) suggests potential reactivity in various chemical reactions, such as nucleophilic additions or reductions. Ethyl esters are generally known for their pleasant odors and are often used in flavoring and fragrance applications. Additionally, the specific arrangement of substituents may impart unique biological activities, making this compound of interest in medicinal chemistry and drug development. Overall, ethyl 7-(3,5-dimethoxyphenyl)-7-oxo-heptanoate presents a diverse range of chemical properties and potential applications.
Formula:C17H24O5
InChI:InChI=1/C17H24O5/c1-4-22-17(19)9-7-5-6-8-16(18)13-10-14(20-2)12-15(11-13)21-3/h10-12H,4-9H2,1-3H3
SMILES:CCOC(=O)CCCCCC(=O)c1cc(cc(c1)OC)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.