CAS 898758-69-5

ethyl 8-(3,5-dimethoxyphenyl)-8-oxo-octanoate

Description:

Ethyl 8-(3,5-dimethoxyphenyl)-8-oxo-octanoate is an organic compound characterized by its ester functional group, which is derived from octanoic acid and an aromatic substituent. The presence of the 3,5-dimethoxyphenyl group indicates that the compound has two methoxy (-OCH3) groups attached to a phenyl ring, contributing to its potential biological activity and solubility properties. The octanoate portion of the molecule suggests a relatively long hydrophobic carbon chain, which may influence its lipophilicity and interaction with biological membranes. The ketone functional group (8-oxo) indicates the presence of a carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its CAS number, 898758-69-5, allows for precise identification in chemical databases and literature. Overall, the combination of functional groups and structural characteristics suggests potential applications in drug development or as a synthetic intermediate in organic chemistry.

Formula: C₁₈H₂₆O₅

InChI: InChI=1/C18H26O5/c1-4-23-18(20)10-8-6-5-7-9-17(19)14-11-15(21-2)13-16(12-14)22-3/h11-13H,4-10H2,1-3H3

SMILES: CCOC(=O)CCCCCCC(=O)c1cc(cc(c1)OC)OC