CAS 898758-73-1
:ethyl 5-(2-acetoxyphenyl)-5-oxo-pentanoate
Description:
Ethyl 5-(2-acetoxyphenyl)-5-oxo-pentanoate, identified by its CAS number 898758-73-1, is an organic compound characterized by its ester functional group and a ketone moiety. This compound features a pentanoate backbone, which is a five-carbon chain with a carbonyl group, and a phenyl ring substituted with an acetoxy group at the para position. The presence of the acetoxy group enhances its reactivity and solubility in organic solvents, making it useful in various chemical applications. Ethyl 5-(2-acetoxyphenyl)-5-oxo-pentanoate may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its structural features suggest it could participate in reactions typical of esters and ketones, such as hydrolysis or condensation. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and pH. As with many organic compounds, safety precautions should be observed when handling it, including the use of appropriate personal protective equipment.
Formula:C15H18O5
InChI:InChI=1/C15H18O5/c1-3-19-15(18)10-6-8-13(17)12-7-4-5-9-14(12)20-11(2)16/h4-5,7,9H,3,6,8,10H2,1-2H3
SMILES:CCOC(=O)CCCC(=O)c1ccccc1OC(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.