CAS 898758-80-0
:5-chloro-1-oxazol-2-yl-pentan-1-one
Description:
5-Chloro-1-oxazol-2-yl-pentan-1-one is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a chlorine atom at the 5-position of the oxazole ring contributes to its reactivity and potential biological activity. The pentan-1-one moiety indicates that the compound has a five-carbon chain with a ketone functional group, which can influence its solubility and polarity. This compound may exhibit properties typical of both oxazole derivatives and ketones, such as potential antimicrobial or antifungal activities, depending on its specific structure and substituents. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions or cycloadditions. Additionally, the compound's unique characteristics make it of interest in medicinal chemistry and material science, where it may serve as a building block for more complex molecules or as a potential therapeutic agent. As with any chemical substance, safety and handling precautions should be observed due to its potential hazards.
Formula:C8H10ClNO2
InChI:InChI=1/C8H10ClNO2/c9-4-2-1-3-7(11)8-10-5-6-12-8/h5-6H,1-4H2
SMILES:C(CCCl)CC(=O)c1ncco1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.