CAS 898758-86-6
:cyclopentyl-oxazol-2-yl-methanone
Description:
Cyclopentyl-oxazol-2-yl-methanone is a chemical compound characterized by its unique structure, which includes a cyclopentyl group and an oxazole ring. The oxazole moiety contributes to its potential biological activity, as oxazoles are often found in various natural products and pharmaceuticals. This compound typically exhibits moderate to high lipophilicity due to the cyclopentyl group, which can influence its solubility and permeability in biological systems. The presence of the methanone functional group suggests that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Additionally, compounds containing oxazole rings are known for their diverse pharmacological properties, including antimicrobial and anti-inflammatory activities. The specific properties, such as melting point, boiling point, and reactivity, would depend on the compound's purity and the conditions under which it is studied. Overall, cyclopentyl-oxazol-2-yl-methanone represents a compound of interest in medicinal chemistry and material science due to its structural features and potential applications.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c11-8(7-3-1-2-4-7)9-10-5-6-12-9/h5-7H,1-4H2
SMILES:C1CCC(C1)C(=O)c1ncco1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.