CAS 898758-87-7

Ethyl 4-(acetyloxy)-ε-oxobenzenehexanoate

Description:

Ethyl 4-(acetyloxy)-ε-oxobenzenehexanoate, with the CAS number 898758-87-7, is an organic compound characterized by its ester functional group and a complex molecular structure. This compound features an ethyl ester moiety, which contributes to its solubility in organic solvents and potential applications in organic synthesis. The presence of the acetyloxy group indicates that it may participate in various chemical reactions, such as esterification or hydrolysis. The ε-oxobenzenehexanoate structure suggests that it has a benzene ring substituted with a hexanoate chain, which can influence its physical properties, such as boiling point and melting point. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structure allows for potential applications in fields such as materials science, medicinal chemistry, and agrochemicals. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₁₆H₂₀O₅

InChI: InChI=1S/C16H20O5/c1-3-20-16(19)7-5-4-6-15(18)13-8-10-14(11-9-13)21-12(2)17/h8-11H,3-7H2,1-2H3

InChI key: InChIKey=VHFCNYBIVUCLAY-UHFFFAOYSA-N

SMILES: C(CCCCC(OCC)=O)(=O)C1=CC=C(OC(C)=O)C=C1

Synonyms:

• Ethyl 4-(acetyloxy)-ε-oxobenzenehexanoate
• Benzenehexanoic acid, 4-(acetyloxy)-ε-oxo-, ethyl ester