CAS 898758-88-8
:cyclohexyl-oxazol-2-yl-methanone
Description:
Cyclohexyl-oxazol-2-yl-methanone is an organic compound characterized by its unique structure, which includes a cyclohexyl group and an oxazole ring. The oxazole moiety contributes to its potential reactivity and biological activity, as oxazoles are known for their presence in various natural products and pharmaceuticals. This compound typically exhibits moderate to high lipophilicity due to the cyclohexyl group, which can influence its solubility and permeability in biological systems. The methanone functional group introduces a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Cyclohexyl-oxazol-2-yl-methanone may also display interesting properties such as fluorescence or photostability, depending on its specific electronic structure. Its applications could range from medicinal chemistry to materials science, although specific uses would depend on further research into its biological activity and chemical behavior. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c12-9(10-11-6-7-13-10)8-4-2-1-3-5-8/h6-8H,1-5H2
SMILES:C1CCC(CC1)C(=O)c1ncco1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.