CAS 898758-99-1
:ethyl 4-(5-fluoro-2-methyl-phenyl)-4-oxo-butanoate
Description:
Ethyl 4-(5-fluoro-2-methyl-phenyl)-4-oxo-butanoate, identified by its CAS number 898758-99-1, is an organic compound characterized by its ester functional group and a complex aromatic structure. This compound features a butanoate backbone, which is linked to a phenyl ring substituted with a fluorine atom and a methyl group, contributing to its unique chemical properties. The presence of the fluorine atom often enhances the compound's lipophilicity and can influence its biological activity. Ethyl 4-(5-fluoro-2-methyl-phenyl)-4-oxo-butanoate may exhibit interesting reactivity due to the carbonyl group (oxo) adjacent to the ester, potentially participating in various chemical reactions such as nucleophilic additions or condensation reactions. This compound is likely to be of interest in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its physical properties, such as solubility and melting point, would depend on the specific conditions and purity of the sample.
Formula:C13H15FO3
InChI:InChI=1/C13H15FO3/c1-3-17-13(16)7-6-12(15)11-8-10(14)5-4-9(11)2/h4-5,8H,3,6-7H2,1-2H3
SMILES:CCOC(=O)CCC(=O)c1cc(ccc1C)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.