CAS 898759-03-0
:ethyl 5-(2-chlorophenyl)-5-oxo-pentanoate
Description:
Ethyl 5-(2-chlorophenyl)-5-oxo-pentanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a pentanoate backbone, indicating a five-carbon chain with a ketone (5-oxo) and an ethyl ester group. The presence of the 2-chlorophenyl substituent introduces a chlorine atom on a phenyl ring, which can influence the compound's reactivity and physical properties, such as solubility and boiling point. Ethyl 5-(2-chlorophenyl)-5-oxo-pentanoate may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of more complex molecules. As with many organic compounds, safety and handling precautions should be observed, as the presence of chlorine can indicate potential toxicity or environmental concerns. Overall, this compound represents a specific class of chemical substances that can be utilized in various chemical and medicinal applications.
Formula:C13H15ClO3
InChI:InChI=1/C13H15ClO3/c1-2-17-13(16)9-5-8-12(15)10-6-3-4-7-11(10)14/h3-4,6-7H,2,5,8-9H2,1H3
SMILES:CCOC(=O)CCCC(=O)c1ccccc1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.