CAS 898759-04-1

2-cyclohexyl-1-oxazol-2-yl-ethanone

Description:

2-Cyclohexyl-1-oxazol-2-yl-ethanone is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a cyclohexyl group, contributing to its hydrophobic characteristics, and an ethanone functional group, which indicates the presence of a carbonyl (C=O) adjacent to an alkyl chain. The oxazole moiety imparts unique chemical properties, including potential reactivity in various organic reactions, such as nucleophilic substitutions or cycloadditions. The presence of the cyclohexyl group may influence the compound's solubility and stability, making it more lipophilic. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods. Overall, 2-cyclohexyl-1-oxazol-2-yl-ethanone represents a versatile structure in organic chemistry with potential applications in various fields.

Formula: C₁₁H₁₅NO₂

InChI: InChI=1/C11H15NO2/c13-10(11-12-6-7-14-11)8-9-4-2-1-3-5-9/h6-7,9H,1-5,8H2

SMILES: C1CCC(CC1)CC(=O)c1ncco1