CAS 898759-07-4
:ethyl 7-(2-chlorophenyl)-7-oxo-heptanoate
Description:
Ethyl 7-(2-chlorophenyl)-7-oxo-heptanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a heptanoate backbone, indicating it has a seven-carbon chain, with a ketone group (7-oxo) at the seventh carbon, contributing to its reactivity and potential applications in organic synthesis. The presence of a 2-chlorophenyl group introduces a chlorine atom on a phenyl ring, which can influence the compound's electronic properties and hydrophobicity, potentially affecting its biological activity and solubility. Ethyl esters like this one are often used in various chemical reactions, including esterification and as intermediates in the synthesis of pharmaceuticals and agrochemicals. The specific arrangement of atoms and functional groups in ethyl 7-(2-chlorophenyl)-7-oxo-heptanoate suggests it may exhibit interesting chemical behavior, making it a subject of interest in medicinal chemistry and material science.
Formula:C15H19ClO3
InChI:InChI=1/C15H19ClO3/c1-2-19-15(18)11-5-3-4-10-14(17)12-8-6-7-9-13(12)16/h6-9H,2-5,10-11H2,1H3
SMILES:CCOC(=O)CCCCCC(=O)c1ccccc1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.