CAS 898759-09-6
:ethyl 8-(2-chlorophenyl)-8-oxo-octanoate
Description:
Ethyl 8-(2-chlorophenyl)-8-oxo-octanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethanol) and a carboxylic acid. This compound features a long carbon chain, specifically an octanoate backbone, which contributes to its hydrophobic properties. The presence of the 2-chlorophenyl group introduces aromatic characteristics and enhances the compound's potential for biological activity, possibly influencing its reactivity and solubility in various solvents. The keto group (8-oxo) indicates that there is a carbonyl functionality within the carbon chain, which can participate in various chemical reactions, such as nucleophilic additions. Ethyl 8-(2-chlorophenyl)-8-oxo-octanoate may be of interest in medicinal chemistry and material science due to its structural features, which could lead to applications in drug development or as an intermediate in organic synthesis. As with many organic compounds, its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of other functional groups.
Formula:C16H21ClO3
InChI:InChI=1/C16H21ClO3/c1-2-20-16(19)12-6-4-3-5-11-15(18)13-9-7-8-10-14(13)17/h7-10H,2-6,11-12H2,1H3
SMILES:CCOC(=O)CCCCCCC(=O)c1ccccc1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.